Difference between revisions of "ACETOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15834 == * common-name: ** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=c(c)c(...")
(Created page with "Category:metabolite == Metabolite MPP-processed-mitochonrial-proteins == * common-name: ** an mpp-processed mitochondrial protein == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15834 ==
+
== Metabolite MPP-processed-mitochonrial-proteins ==
 
* common-name:
 
* common-name:
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
+
** an mpp-processed mitochondrial protein
* smiles:
 
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=c(c)c(o)=c1))c)c
 
* inchi-key:
 
** qfmvwsptqocgtb-tuzvqdltsa-n
 
* molecular-weight:
 
** 410.639
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.24.59-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14917]]
+
* [[3.4.24.64-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: common-name=an mpp-processed mitochondrial protein}}
{{#set: inchi-key=inchikey=qfmvwsptqocgtb-tuzvqdltsa-n}}
 
{{#set: molecular-weight=410.639}}
 

Revision as of 18:53, 14 January 2021

Metabolite MPP-processed-mitochonrial-proteins

  • common-name:
    • an mpp-processed mitochondrial protein

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality