Difference between revisions of "ACETYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17313 == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
(Created page with "Category:metabolite == Metabolite ACETYL-ACP == * common-name: ** an acetyl-[acp] == Reaction(s) known to consume the compound == * 3-OXOACYL-ACP-SYNTH-BASE-RXN * AC...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17313 ==
+
== Metabolite ACETYL-ACP ==
 
* common-name:
 
* common-name:
** sapienoyl-coa
+
** an acetyl-[acp]
* smiles:
 
** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** pvzuhjmomjkuef-hatlacbzsa-j
 
* molecular-weight:
 
** 999.899
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-OXOACYL-ACP-SYNTH-BASE-RXN]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16065]]
+
* [[ACP-S-ACETYLTRANSFER-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sapienoyl-coa}}
+
{{#set: common-name=an acetyl-[acp]}}
{{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}}
 
{{#set: molecular-weight=999.899}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite ACETYL-ACP

  • common-name:
    • an acetyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an acetyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.