Difference between revisions of "ACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17477 == * transcription-direction: ** negative * right-end-position: ** 154277 * left-end-position: ** 144079 * centisome-position: ** 55.04493...")
 
(Created page with "Category:metabolite == Metabolite ACETYL-COA == * common-name: ** acetyl-coa * smiles: ** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17477 ==
+
== Metabolite ACETYL-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** acetyl-coa
* right-end-position:
+
* smiles:
** 154277
+
** cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 144079
+
** zslzbfcdcinbpy-zsjpkinusa-j
* centisome-position:
+
* molecular-weight:
** 55.04493   
+
** 805.54
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[1.2.1.18-RXN]]
* [[ATPASE-RXN]]
+
* [[2-ISOPROPYLMALATESYN-RXN]]
** Category: [[annotation]]
+
* [[2.3.1.157-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[2.3.1.180-RXN]]
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[2.3.1.45-RXN]]
** Category: [[annotation]]
+
* [[2.3.1.67-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACACT]]
* [[RXN-12195]]
+
* [[ACACT1h]]
** Category: [[annotation]]
+
* [[ACACT2h]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACACT4]]
* [[RXN-12196]]
+
* [[ACACT4h]]
** Category: [[annotation]]
+
* [[ACACT6]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACACT6h]]
* [[RXN0-5462]]
+
* [[ACACT7]]
** Category: [[annotation]]
+
* [[ACACT7h]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACACT7m]]
== Pathway(s) associated ==
+
* [[ACCOAth]]
* [[PWY-7210]]
+
* [[ACCOAtm]]
** '''8''' reactions found over '''8''' reactions in the full pathway
+
* [[ACCOAtx]]
* [[PWY-7198]]
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
** '''6''' reactions found over '''7''' reactions in the full pathway
+
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
* [[PWY-7184]]
+
* [[ACP-S-ACETYLTRANSFER-RXN]]
** '''9''' reactions found over '''9''' reactions in the full pathway
+
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
* [[PWY-6545]]
+
* [[CITSYN-RXN]]
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[CSm]]
{{#set: transcription-direction=negative}}
+
* [[DIHYDLIPACETRANS-RXN]]
{{#set: right-end-position=154277}}
+
* [[FATTY-ACID-SYNTHASE-RXN]]
{{#set: left-end-position=144079}}
+
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
{{#set: centisome-position=55.04493    }}
+
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
{{#set: nb reaction associated=5}}
+
* [[IPMS]]
{{#set: nb pathway associated=4}}
+
* [[MALSYN-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[PHOSACETYLTRANS-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[RXN-12565]]
 +
* [[RXN-13431]]
 +
* [[RXN-14274]]
 +
* [[RXN-14277]]
 +
* [[RXN-16016]]
 +
* [[RXN-16017]]
 +
* [[RXN-7864]]
 +
* [[RXN-8032]]
 +
* [[RXN0-5055]]
 +
* [[RXN0-6948]]
 +
* [[SERINE-O-ACETTRAN-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.2.1.18-RXN]]
 +
* [[2.3.1.45-RXN]]
 +
* [[2.3.1.67-RXN]]
 +
* [[ACACT1h]]
 +
* [[ACACT4]]
 +
* [[ACACT6]]
 +
* [[ACACT7]]
 +
* [[ACCAT]]
 +
* [[ACCOAth]]
 +
* [[ACCOAtm]]
 +
* [[ACCOAtx]]
 +
* [[ACECOATRANS-RXN-CPD-10280/ACET//TETRACOSANOATE/ACETYL-COA.42.]]
 +
* [[ACECOATRANS-RXN-CPD-14717/ACET//R-2-HYDROXYSTEARATE/ACETYL-COA.47.]]
 +
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
 +
* [[ACECOATRANS-RXN-HEXANOYL-COA/ACET//HEXANOATE/ACETYL-COA.40.]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
* [[ACOACXr]]
 +
* [[ACP-S-ACETYLTRANSFER-RXN]]
 +
* [[AKBLIG-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPCL]]
 +
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-LYASE-RXN]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[N-ACETYLTRANSFER-RXN]]
 +
* [[PHOSACETYLTRANS-RXN]]
 +
* [[PYFLAVOXRE-RXN]]
 +
* [[PYRUFLAVREDUCT-RXN]]
 +
* [[PYRUVDEH-RXN]]
 +
* [[RXN-10699]]
 +
* [[RXN-10700]]
 +
* [[RXN-10701]]
 +
* [[RXN-11246]]
 +
* [[RXN-11917]]
 +
* [[RXN-11921]]
 +
* [[RXN-12561]]
 +
* [[RXN-12710]]
 +
* [[RXN-13617]]
 +
* [[RXN-14268]]
 +
* [[RXN-14274]]
 +
* [[RXN-14277]]
 +
* [[RXN-14394]]
 +
* [[RXN-14774]]
 +
* [[RXN-14788]]
 +
* [[RXN-14793]]
 +
* [[RXN-14799]]
 +
* [[RXN-14803]]
 +
* [[RXN-16137]]
 +
* [[RXN-17116]]
 +
* [[RXN-17778]]
 +
* [[RXN-17782]]
 +
* [[RXN-17787]]
 +
* [[RXN-17791]]
 +
* [[RXN-17795]]
 +
* [[RXN-17799]]
 +
* [[RXN-2006]]
 +
* [[RXN-2902]]
 +
* [[RXN-7864]]
 +
* [[RXN-8032]]
 +
* [[RXN-9958]]
 +
* [[RXN0-1133]]
 +
</div>
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=acetyl-coa}}
 +
{{#set: inchi-key=inchikey=zslzbfcdcinbpy-zsjpkinusa-j}}
 +
{{#set: molecular-weight=805.54}}

Latest revision as of 11:11, 18 March 2021

Metabolite ACETYL-COA

  • common-name:
    • acetyl-coa
  • smiles:
    • cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zslzbfcdcinbpy-zsjpkinusa-j
  • molecular-weight:
    • 805.54

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality