Difference between revisions of "ACETYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07458 == * transcription-direction: ** negative * right-end-position: ** 310047 * left-end-position: ** 296793 * centisome-position: ** 65.17638...")
(Created page with "Category:metabolite == Metabolite 3-INDOLYLGLYCOLALDEHYDE == * common-name: ** indole-3-glycol aldehyde * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) * inchi-key: ** xkzdnwm...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07458 ==
+
== Metabolite 3-INDOLYLGLYCOLALDEHYDE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** indole-3-glycol aldehyde
−
* right-end-position:
+
* smiles:
−
** 310047
+
** c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
−
* left-end-position:
+
* inchi-key:
−
** 296793
+
** xkzdnwmdlgqxml-uhfffaoysa-n
−
* centisome-position:
+
* molecular-weight:
−
** 65.17638   
+
** 175.187
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-5424]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[AMCL]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=indole-3-glycol aldehyde}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}}
−
* [[SAMDECARB-RXN]]
+
{{#set: molecular-weight=175.187}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[BSUBPOLYAMSYN-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6834]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[ARGSPECAT-PWY]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=310047}}
 
−
{{#set: left-end-position=296793}}
 
−
{{#set: centisome-position=65.17638    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite 3-INDOLYLGLYCOLALDEHYDE

  • common-name:
    • indole-3-glycol aldehyde
  • smiles:
    • c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
  • inchi-key:
    • xkzdnwmdlgqxml-uhfffaoysa-n
  • molecular-weight:
    • 175.187

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ACETYL-COA&oldid=45721"