Difference between revisions of "ACETYL-ETCETERA-L-ASPARAGINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11047 == * transcription-direction: ** negative * right-end-position: ** 498112 * left-end-position: ** 491882 * centisome-position: ** 62.62383...") |
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == |
| − | * | + | * common-name: |
| − | ** | + | ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine |
| − | + | * smiles: | |
| − | + | ** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1) | |
| − | + | * inchi-key: | |
| − | + | ** yttrpbwemmpysw-hrrfrdkfsa-n | |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 335.313 |
| − | = | + | == Reaction(s) known to consume the compound == |
| − | + | * [[3.5.1.26-RXN]] | |
| − | = | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}} |
| − | ** | + | {{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}} |
| − | * | + | {{#set: molecular-weight=335.313}} |
| − | ** | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite ACETYL-ETCETERA-L-ASPARAGINE
- common-name:
- n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
- smiles:
- cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
- inchi-key:
- yttrpbwemmpysw-hrrfrdkfsa-n
- molecular-weight:
- 335.313
