Difference between revisions of "ACETYL-GLU"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6321 == * common-name: ** a [procollagen] trans 4-hyroxy-l-proline == Reaction(s) known to consume the compound == == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite CPD-11740 == * common-name: ** carboxyphosphinopyruvate * smiles: ** c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-] * inchi-key: ** ytkwpnbypyowcp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-11740 == |
* common-name: | * common-name: | ||
| − | ** | + | ** carboxyphosphinopyruvate |
| + | * smiles: | ||
| + | ** c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** ytkwpnbypyowcp-uhfffaoysa-k | ||
| + | * molecular-weight: | ||
| + | ** 193.029 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10828]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10827]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=carboxyphosphinopyruvate}} |
| + | {{#set: inchi-key=inchikey=ytkwpnbypyowcp-uhfffaoysa-k}} | ||
| + | {{#set: molecular-weight=193.029}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite CPD-11740
- common-name:
- carboxyphosphinopyruvate
- smiles:
- c(p(c([o-])=o)([o-])=o)c(=o)c(=o)[o-]
- inchi-key:
- ytkwpnbypyowcp-uhfffaoysa-k
- molecular-weight:
- 193.029
