Difference between revisions of "ACETYL-GLU"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18002 == * transcription-direction: ** negative * right-end-position: ** 372498 * left-end-position: ** 368587 * centisome-position: ** 56.150322...") |
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvs...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ACETYL-GLU == |
− | * | + | * common-name: |
− | ** | + | ** n-acetyl-l-glutamate |
− | + | * smiles: | |
− | + | ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] | |
− | + | * inchi-key: | |
− | + | ** rfmmmvdnipukgg-yfkpbyrvsa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 187.152 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[ACETYLGLUTKIN-RXN]] | |
− | == | + | * [[AGK]] |
− | + | * [[N-ACETYLTRANSFER-RXN]] | |
− | * | + | == Reaction(s) known to produce the compound == |
− | ** | + | * [[ACETYLGLUTKIN-RXN]] |
− | + | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] | |
− | * | + | * [[N-ACETYLTRANSFER-RXN]] |
− | ** | + | == Reaction(s) of unknown directionality == |
− | * [[RXN | + | {{#set: common-name=n-acetyl-l-glutamate}} |
− | + | {{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}} | |
− | * | + | {{#set: molecular-weight=187.152}} |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ACETYL-GLU
- common-name:
- n-acetyl-l-glutamate
- smiles:
- cc(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- rfmmmvdnipukgg-yfkpbyrvsa-l
- molecular-weight:
- 187.152