Difference between revisions of "ACETYL-GLU"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ETF-Oxidized == * common-name: ** an oxidized electron-transfer flavoprotein == Reaction(s) known to consume the compound == * 1.5.5.1-...") |
(Created page with "Category:metabolite == Metabolite ACETYL-GLU == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] * inchi-key: ** rfmmmvdnipukgg-yfkpbyrvs...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACETYL-GLU == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-l-glutamate |
| + | * smiles: | ||
| + | ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** rfmmmvdnipukgg-yfkpbyrvsa-l | ||
| + | * molecular-weight: | ||
| + | ** 187.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ACETYLGLUTKIN-RXN]] |
| − | * [[ | + | * [[AGK]] |
| − | + | * [[N-ACETYLTRANSFER-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACETYLGLUTKIN-RXN]] |
| − | * [[ | + | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] |
| − | * [[ | + | * [[N-ACETYLTRANSFER-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-l-glutamate}} |
| + | {{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}} | ||
| + | {{#set: molecular-weight=187.152}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ACETYL-GLU
- common-name:
- n-acetyl-l-glutamate
- smiles:
- cc(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- rfmmmvdnipukgg-yfkpbyrvsa-l
- molecular-weight:
- 187.152
