Difference between revisions of "ACETYL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13887 == * common-name: ** (25s)-26-hydroxycholest-4-en-3-one * smiles: ** cc(co)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2c...") |
(Created page with "Category:metabolite == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == * common-name: ** γ-l-glutamyl-l-cysteine * smiles: ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-GAMMA-GLUTAMYLCYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-l-glutamyl-l-cysteine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ritkhvbhsgluln-whfbiakzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 249.261 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[GLUTATHIONE-SYN-RXN]] |
| + | * [[RXN-14430]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[GLUTCYSLIG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ritkhvbhsgluln-whfbiakzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=249.261}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite L-GAMMA-GLUTAMYLCYSTEINE
- common-name:
- γ-l-glutamyl-l-cysteine
- smiles:
- c(s)c(c([o-])=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- ritkhvbhsgluln-whfbiakzsa-m
- molecular-weight:
- 249.261
