Difference between revisions of "ACETYL-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DPG == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] * inchi-key: ** ljqlqc...") |
(Created page with "Category:metabolite == Metabolite ACETYL-P == * common-name: ** acetyl phosphate * smiles: ** cc(op([o-])(=o)[o-])=o * inchi-key: ** lipounrjvlnbcd-uhfffaoysa-l * molecula...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACETYL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** acetyl phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(op([o-])(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lipounrjvlnbcd-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 138.016 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
| − | + | * [[PHOSACETYLTRANS-RXN]] | |
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[LYSINE-N-ACETYLTRANSFERASE-RXN]] |
| − | + | * [[PHOSACETYLTRANS-RXN]] | |
| − | |||
| − | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=acetyl phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lipounrjvlnbcd-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=138.016}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ACETYL-P
- common-name:
- acetyl phosphate
- smiles:
- cc(op([o-])(=o)[o-])=o
- inchi-key:
- lipounrjvlnbcd-uhfffaoysa-l
- molecular-weight:
- 138.016
