Difference between revisions of "ACETYLCHOLINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE-PYROPHOSPHATE == * common-name: ** thiamine diphosphate * smiles: ** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)...")
(Created page with "Category:metabolite == Metabolite ACETYLCHOLINE == * common-name: ** acetylcholine * smiles: ** cc(=o)occ[n+](c)(c)c * inchi-key: ** oipilfwxsmykgl-uhfffaoysa-n * molecula...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE-PYROPHOSPHATE ==
+
== Metabolite ACETYLCHOLINE ==
 
* common-name:
 
* common-name:
** thiamine diphosphate
+
** acetylcholine
 
* smiles:
 
* smiles:
** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+
** cc(=o)occ[n+](c)(c)c
 
* inchi-key:
 
* inchi-key:
** ayekofbpnlcajy-uhfffaoysa-l
+
** oipilfwxsmykgl-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 422.288
+
** 146.209
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12583]]
+
* [[ACETYLCHOLINESTERASE-RXN]]
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PDHam2hi]]
 
* [[PDHam2mi]]
 
* [[RXN-12508]]
 
* [[RXN-14037]]
 
* [[RXN0-3542]]
 
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMIN-TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine diphosphate}}
+
{{#set: common-name=acetylcholine}}
{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=oipilfwxsmykgl-uhfffaoysa-n}}
{{#set: molecular-weight=422.288}}
+
{{#set: molecular-weight=146.209}}

Latest revision as of 11:18, 18 March 2021

Metabolite ACETYLCHOLINE

  • common-name:
    • acetylcholine
  • smiles:
    • cc(=o)occ[n+](c)(c)c
  • inchi-key:
    • oipilfwxsmykgl-uhfffaoysa-n
  • molecular-weight:
    • 146.209

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality