Difference between revisions of "ACRYLAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12017 == * common-name: ** n-acetyl-serotonin sulfate * smiles: ** cc(=o)nccc1(=cnc2(=cc=c(os([o-])(=o)=o)c=c12)) * inchi-key: ** uca...") |
(Created page with "Category:metabolite == Metabolite ACRYLAMIDE == * common-name: ** acrylamide * smiles: ** c=cc(=o)n * inchi-key: ** hrpvxlwxlxdghg-uhfffaoysa-n * molecular-weight: ** 71.0...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACRYLAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** acrylamide |
* smiles: | * smiles: | ||
− | ** | + | ** c=cc(=o)n |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hrpvxlwxlxdghg-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 71.079 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[R311-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=acrylamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hrpvxlwxlxdghg-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=71.079}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ACRYLAMIDE
- common-name:
- acrylamide
- smiles:
- c=cc(=o)n
- inchi-key:
- hrpvxlwxlxdghg-uhfffaoysa-n
- molecular-weight:
- 71.079