Difference between revisions of "ACRYLAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...") |
(Created page with "Category:metabolite == Metabolite MAP-Kinase-L-Phosphotyrosine == * common-name: ** a [mitogen-activated protein kinase] l-tyrosine phosphate == Reaction(s) known to consu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite MAP-Kinase-L-Phosphotyrosine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [mitogen-activated protein kinase] l-tyrosine phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16317]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16317]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [mitogen-activated protein kinase] l-tyrosine phosphate}} |
| − | |||
| − | |||
Revision as of 14:55, 5 January 2021
Contents
Metabolite MAP-Kinase-L-Phosphotyrosine
- common-name:
- a [mitogen-activated protein kinase] l-tyrosine phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [mitogen-activated protein kinase] l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
