Difference between revisions of "ACRYLAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17387 == * transcription-direction: ** positive * right-end-position: ** 264120 * left-end-position: ** 263461 * centisome-position: ** 77.13055...") |
(Created page with "Category:metabolite == Metabolite CPD-3705 == * common-name: ** adenosine 2'-monophosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-3705 == |
| − | * | + | * common-name: |
| − | ** | + | ** adenosine 2'-monophosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o |
| − | * | + | * inchi-key: |
| − | ** | + | ** qdfhpfsbqfllsw-kqynxxcusa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 345.208 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-12057]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=adenosine 2'-monophosphate}} | |
| − | + | {{#set: inchi-key=inchikey=qdfhpfsbqfllsw-kqynxxcusa-l}} | |
| − | {{#set: | + | {{#set: molecular-weight=345.208}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-3705
- common-name:
- adenosine 2'-monophosphate
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)op(=o)([o-])[o-])o))o
- inchi-key:
- qdfhpfsbqfllsw-kqynxxcusa-l
- molecular-weight:
- 345.208
