Difference between revisions of "ACRYLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
(Created page with "Category:metabolite == Metabolite ACRYLATE == * common-name: ** acrylate * smiles: ** c=cc([o-])=o * inchi-key: ** nixowildqlnwcw-uhfffaoysa-m * molecular-weight: ** 71.05...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CINNAMOYL-COA ==
+
== Metabolite ACRYLATE ==
 
* common-name:
 
* common-name:
** (e)-cinnamoyl-coa
+
** acrylate
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c=cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** jvnvhnhitfvwix-kzkudurgsa-j
+
** nixowildqlnwcw-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 893.648
+
** 71.055
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7645]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2001]]
+
* [[R311-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-cinnamoyl-coa}}
+
{{#set: common-name=acrylate}}
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
+
{{#set: inchi-key=inchikey=nixowildqlnwcw-uhfffaoysa-m}}
{{#set: molecular-weight=893.648}}
+
{{#set: molecular-weight=71.055}}

Latest revision as of 11:13, 18 March 2021

Metabolite ACRYLATE

  • common-name:
    • acrylate
  • smiles:
    • c=cc([o-])=o
  • inchi-key:
    • nixowildqlnwcw-uhfffaoysa-m
  • molecular-weight:
    • 71.055

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality