Difference between revisions of "ACRYLATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15252 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CINNAMOYL-COA == |
| − | == | + | * common-name: |
| − | + | ** (e)-cinnamoyl-coa | |
| − | = | + | * smiles: |
| − | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | |
| − | * | + | * inchi-key: |
| − | *** | + | ** jvnvhnhitfvwix-kzkudurgsa-j |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 893.648 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * [[ | + | * [[RXN-7645]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[RXN-2001]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=(e)-cinnamoyl-coa}} |
| + | {{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}} | ||
| + | {{#set: molecular-weight=893.648}} | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CINNAMOYL-COA
- common-name:
- (e)-cinnamoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- jvnvhnhitfvwix-kzkudurgsa-j
- molecular-weight:
- 893.648
