Difference between revisions of "ACRYLYL-COA"

Revision as of 08:25, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-11412 ==
+== Metabolite PHOSPHO-ENOL-PYRUVATE ==
 * common-name:
-** triiodothyroacetate ester glucuronide
+** phosphoenolpyruvate
 * smiles:
-** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
+** c=c(op([o-])([o-])=o)c([o-])=o
 * inchi-key:
-** fpejnmnxcsitjo-kfyubchvsa-m
+** dtbnbxwjwcwcik-uhfffaoysa-k
 * molecular-weight:
-** 797.054
+** 165.019
 == Reaction(s) known to consume the compound ==
+* [[2.5.1.19-RXN]]
+* [[2PGADEHYDRAT-RXN]]
+* [[DAHPSYN-RXN]]
+* [[GTPOP]]
+* [[PEPCARBOX-RXN]]
+* [[PEPDEPHOS-RXN]]
+* [[PEPPIth]]
+* [[PPC]]
+* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
+* [[RXN-14117]]
+* [[RXN-14192]]
+* [[RXN-14207]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10618]]
+* [[2.5.1.19-RXN]]
+* [[2PGADEHYDRAT-RXN]]
+* [[DAHPSYN-RXN]]
+* [[PEPCARBOXYKIN-RXN]]
+* [[PEPPIth]]
+* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=triiodothyroacetate ester glucuronide}}
+{{#set: common-name=phosphoenolpyruvate}}
-{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
+{{#set: inchi-key=inchikey=dtbnbxwjwcwcik-uhfffaoysa-k}}
-{{#set: molecular-weight=797.054}}
+{{#set: molecular-weight=165.019}}