Difference between revisions of "ACRYLYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11412 == * common-name: ** triiodothyroacetate ester glucuronide * smiles: ** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)...")
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11412 ==
+
== Metabolite ACRYLYL-COA ==
 
* common-name:
 
* common-name:
** triiodothyroacetate ester glucuronide
+
** acryloyl-coa
 
* smiles:
 
* smiles:
** c(oc1(c(o)c(o)c(o)c(c(=o)[o-])o1))(=o)cc2(c=c(i)c(=c(i)c=2)oc3(=cc(i)=c(o)c=c3))
+
** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** fpejnmnxcsitjo-kfyubchvsa-m
+
** poodsgumucvrtr-iexphmlfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 797.054
+
** 817.551
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[PPCOAOm]]
 +
* [[RXN-6383]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10618]]
+
* [[PPCOAOm]]
 +
* [[RXN-6383]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyroacetate ester glucuronide}}
+
{{#set: common-name=acryloyl-coa}}
{{#set: inchi-key=inchikey=fpejnmnxcsitjo-kfyubchvsa-m}}
+
{{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}}
{{#set: molecular-weight=797.054}}
+
{{#set: molecular-weight=817.551}}

Latest revision as of 11:12, 18 March 2021

Metabolite ACRYLYL-COA

  • common-name:
    • acryloyl-coa
  • smiles:
    • c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • poodsgumucvrtr-iexphmlfsa-j
  • molecular-weight:
    • 817.551

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality