Difference between revisions of "ACRYLYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ox-NADPH-Hemoprotein-Reductases == * common-name: ** an oxidized [nadph-hemoprotein reductase] == Reaction(s) known to consume the compou...") |
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ACRYLYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** acryloyl-coa |
+ | * smiles: | ||
+ | ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** poodsgumucvrtr-iexphmlfsa-j | ||
+ | * molecular-weight: | ||
+ | ** 817.551 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[PPCOAOm]] |
+ | * [[RXN-6383]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PPCOAOm]] |
− | + | * [[RXN-6383]] | |
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=acryloyl-coa}} |
+ | {{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}} | ||
+ | {{#set: molecular-weight=817.551}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite ACRYLYL-COA
- common-name:
- acryloyl-coa
- smiles:
- c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- poodsgumucvrtr-iexphmlfsa-j
- molecular-weight:
- 817.551