Difference between revisions of "ACRYLYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12259 == * transcription-direction: ** negative * right-end-position: ** 159926 * left-end-position: ** 154250 * centisome-position: ** 42.831993...") |
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ACRYLYL-COA == |
| − | * | + | * common-name: |
| − | ** | + | ** acryloyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** poodsgumucvrtr-iexphmlfsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 817.551 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[PPCOAOm]] |
| − | == Reaction(s) | + | * [[RXN-6383]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[PPCOAOm]] |
| − | + | * [[RXN-6383]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=acryloyl-coa}} | |
| − | + | {{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}} | |
| − | == | + | {{#set: molecular-weight=817.551}} |
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite ACRYLYL-COA
- common-name:
- acryloyl-coa
- smiles:
- c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- poodsgumucvrtr-iexphmlfsa-j
- molecular-weight:
- 817.551
