Difference between revisions of "ACTINOMYCIN-D"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BIOMASS == == Reaction(s) known to consume the compound == * Exchange_BIOMASS * Transport_BIOMASS == Reaction(s) known to produce...") |
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIHYDROXYNAPHTHOATE == |
+ | * common-name: | ||
+ | ** 2-carboxy-1,4-naphthoquinol | ||
+ | * smiles: | ||
+ | ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) | ||
+ | * inchi-key: | ||
+ | ** vojuxhhacrxltd-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 203.174 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[NPHS]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=2-carboxy-1,4-naphthoquinol}} | ||
+ | {{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=203.174}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite DIHYDROXYNAPHTHOATE
- common-name:
- 2-carboxy-1,4-naphthoquinol
- smiles:
- c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
- inchi-key:
- vojuxhhacrxltd-uhfffaoysa-m
- molecular-weight:
- 203.174