Difference between revisions of "ACTINOMYCIN-D"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BIOMASS == == Reaction(s) known to consume the compound == * Exchange_BIOMASS * Transport_BIOMASS == Reaction(s) known to produce...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYNAPHTHOATE == * common-name: ** 2-carboxy-1,4-naphthoquinol * smiles: ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BIOMASS ==
+
== Metabolite DIHYDROXYNAPHTHOATE ==
 +
* common-name:
 +
** 2-carboxy-1,4-naphthoquinol
 +
* smiles:
 +
** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
 +
* inchi-key:
 +
** vojuxhhacrxltd-uhfffaoysa-m
 +
* molecular-weight:
 +
** 203.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[Exchange_BIOMASS]]
+
* [[NPHS]]
* [[Transport_BIOMASS]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[Exchange_BIOMASS]]
 
* [[Transport_BIOMASS]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=2-carboxy-1,4-naphthoquinol}}
 +
{{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}}
 +
{{#set: molecular-weight=203.174}}

Revision as of 08:29, 15 March 2021

Metabolite DIHYDROXYNAPHTHOATE

  • common-name:
    • 2-carboxy-1,4-naphthoquinol
  • smiles:
    • c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2))
  • inchi-key:
    • vojuxhhacrxltd-uhfffaoysa-m
  • molecular-weight:
    • 203.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality