Difference between revisions of "ACYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ15148 == * transcription-direction: ** negative * right-end-position: ** 191006 * left-end-position: ** 159812 * centisome-position: ** 53.162216...") |
(Created page with "Category:metabolite == Metabolite DTDP-DEOH-DEOXY-MANNOSE == * common-name: ** dtdp-4-dehydro-β-l-rhamnose * smiles: ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DTDP-DEOH-DEOXY-MANNOSE == |
| − | * | + | * common-name: |
| − | ** | + | ** dtdp-4-dehydro-β-l-rhamnose |
| − | * | + | * smiles: |
| − | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** psxwnitxwwecny-lpvgzgshsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 544.302 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[DTDPDEHYDRHAMEPIM-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=dtdp-4-dehydro-β-l-rhamnose}} | |
| − | + | {{#set: inchi-key=inchikey=psxwnitxwwecny-lpvgzgshsa-l}} | |
| − | + | {{#set: molecular-weight=544.302}} | |
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite DTDP-DEOH-DEOXY-MANNOSE
- common-name:
- dtdp-4-dehydro-β-l-rhamnose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
- inchi-key:
- psxwnitxwwecny-lpvgzgshsa-l
- molecular-weight:
- 544.302
