Difference between revisions of "ACYL-COA"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE ==
+== Metabolite ACYL-COA ==
 * common-name:
-** luteolin 7-o-&beta;-d-diglucuronide
+** an acyl-coa
-* smiles:
-** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o
-* inchi-key:
-** pbbvwjqpazyqdb-dbfweqbmsa-l
-* molecular-weight:
-** 636.476
 == Reaction(s) known to consume the compound ==
-* [[RXN-15288]]
+* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+* [[2.3.1.23-RXN]]
+* [[ACYL-COA-HYDROLASE-RXN]]
+* [[ACYL-COA-OXIDASE-RXN]]
+* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+* [[PLASMALOGEN-SYNTHASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-13112]]
+* [[RXN-1381]]
+* [[RXN-1623]]
+* [[RXN-17729]]
+* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 == Reaction(s) known to produce the compound ==
+* [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+* [[2.3.1.23-RXN]]
+* [[BUTYRATE--COA-LIGASE-RXN]]
+* [[PLASMALOGEN-SYNTHASE-RXN]]
+* [[RETINOL-O-FATTY-ACYLTRANSFERASE-RXN]]
+* [[RXN-13112]]
+* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=luteolin 7-o-&beta;-d-diglucuronide}}
+{{#set: common-name=an acyl-coa}}
-{{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}}
-{{#set: molecular-weight=636.476}}