Difference between revisions of "ADENINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoate * smiles: ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) * inch...") |
(Created page with "Category:metabolite == Metabolite 2-Methoxy-6-Polyprenyl-14-Benzoquinols == * common-name: ** a 2-methoxy-6-all-trans-polyprenyl-1,4-benzoquinol == Reaction(s) known to co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-Methoxy-6-Polyprenyl-14-Benzoquinols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-methoxy-6-all-trans-polyprenyl-1,4-benzoquinol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11754]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-methoxy-6-all-trans-polyprenyl-1,4-benzoquinol}} |
| − | |||
| − | |||
Revision as of 11:18, 15 January 2021
Contents
Metabolite 2-Methoxy-6-Polyprenyl-14-Benzoquinols
- common-name:
- a 2-methoxy-6-all-trans-polyprenyl-1,4-benzoquinol
