Difference between revisions of "ADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07645 == * transcription-direction: ** negative * right-end-position: ** 37405 * left-end-position: ** 19224 * centisome-position: ** 30.035152...")
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ07645 ==
+
== Metabolite ADENOSINE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** adenosine
−
* right-end-position:
+
* smiles:
−
** 37405
+
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
−
* left-end-position:
+
* inchi-key:
−
** 19224
+
** oirdtqyftabqoq-kqynxxcusa-n
−
* centisome-position:
+
* molecular-weight:
−
** 30.035152   
+
** 267.244
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ADENODEAMIN-RXN]]
−
== Reaction(s) associated ==
+
* [[ADENOSINE-KINASE-RXN]]
−
* [[ATPASE-RXN]]
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
−
** Category: [[annotation]]
+
* [[ADENPHOSPHOR-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADNK]]
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
* [[ADNKm]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
−
* [[RXN-11109]]
+
* [[ADENPHOSPHOR-RXN]]
−
** Category: [[annotation]]
+
* [[AMP-DEPHOSPHORYLATION-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AMP5N]]
−
* [[RXN-12195]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=adenosine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}}
−
* [[RXN-12196]]
+
{{#set: molecular-weight=267.244}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=37405}}
 
−
{{#set: left-end-position=19224}}
 
−
{{#set: centisome-position=30.035152    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite ADENOSINE

  • common-name:
    • adenosine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
  • inchi-key:
    • oirdtqyftabqoq-kqynxxcusa-n
  • molecular-weight:
    • 267.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ADENOSINE&oldid=136829"