Difference between revisions of "ADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13759 == * transcription-direction: ** positive * right-end-position: ** 155902 * left-end-position: ** 142445 * centisome-position: ** 42.980724...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ADENOSINE == |
− | * | + | * common-name: |
− | ** | + | ** adenosine |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** oirdtqyftabqoq-kqynxxcusa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 267.244 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ADENODEAMIN-RXN]] |
− | == Reaction(s) | + | * [[ADENOSINE-KINASE-RXN]] |
− | * [[RXN | + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
− | * | + | * [[ADENPHOSPHOR-RXN]] |
− | * | + | * [[ADNK]] |
− | {{#set: | + | * [[ADNKm]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] | |
− | {{#set: | + | * [[ADENPHOSPHOR-RXN]] |
− | + | * [[AMP-DEPHOSPHORYLATION-RXN]] | |
− | + | * [[AMP5N]] | |
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=adenosine}} | ||
+ | {{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}} | ||
+ | {{#set: molecular-weight=267.244}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ADENOSINE
- common-name:
- adenosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
- inchi-key:
- oirdtqyftabqoq-kqynxxcusa-n
- molecular-weight:
- 267.244