Difference between revisions of "ADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-O-Methylcytidine-32-tRNAs == * common-name: ** a 2'-o-methylcytidine32 in trna == Reaction(s) known to consume the compound == == React...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ADENOSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** adenosine |
+ | * smiles: | ||
+ | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) | ||
+ | * inchi-key: | ||
+ | ** oirdtqyftabqoq-kqynxxcusa-n | ||
+ | * molecular-weight: | ||
+ | ** 267.244 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ADENODEAMIN-RXN]] | ||
+ | * [[ADENOSINE-KINASE-RXN]] | ||
+ | * [[ADENOSYLHOMOCYSTEINASE-RXN]] | ||
+ | * [[ADENPHOSPHOR-RXN]] | ||
+ | * [[ADNK]] | ||
+ | * [[ADNKm]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ADENOSYLHOMOCYSTEINASE-RXN]] |
+ | * [[ADENPHOSPHOR-RXN]] | ||
+ | * [[AMP-DEPHOSPHORYLATION-RXN]] | ||
+ | * [[AMP5N]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=adenosine}} |
+ | {{#set: inchi-key=inchikey=oirdtqyftabqoq-kqynxxcusa-n}} | ||
+ | {{#set: molecular-weight=267.244}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ADENOSINE
- common-name:
- adenosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23)))
- inchi-key:
- oirdtqyftabqoq-kqynxxcusa-n
- molecular-weight:
- 267.244