Difference between revisions of "ADENOSINE5TRIPHOSPHO5ADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ08428 == * transcription-direction: ** positive * right-end-position: ** 413135 * left-end-position: ** 407387 * centisome-position: ** 92.31897...")
(Created page with "Category:metabolite == Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE == * common-name: ** 5',5'''-diadenosine triphosphate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ08428 ==
+
== Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE ==
* transcription-direction:
+
* common-name:
** positive
+
** 5',5'''-diadenosine triphosphate
* right-end-position:
+
* smiles:
** 413135
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
* left-end-position:
+
* inchi-key:
** 407387
+
** qcicupzzliqapa-xpwfqurosa-k
* centisome-position:
+
* molecular-weight:
** 92.31897   
+
** 753.388
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=5',5'''-diadenosine triphosphate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=qcicupzzliqapa-xpwfqurosa-k}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=753.388}}
* [[TRIGLSYN-PWY]]
 
** '''5''' reactions found over '''7''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=413135}}
 
{{#set: left-end-position=407387}}
 
{{#set: centisome-position=92.31897    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite ADENOSINE5TRIPHOSPHO5ADENOSINE

  • common-name:
    • 5',5-diadenosine triphosphate
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])op(=o)([o-])op(=o)([o-])occ6(c(c(c(n5(c4(=c(c(=nc=n4)n)n=c5)))o6)o)o)
  • inchi-key:
    • qcicupzzliqapa-xpwfqurosa-k
  • molecular-weight:
    • 753.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality