Difference between revisions of "ADENOSINE5TRIPHOSPHO5ADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14807 == * transcription-direction: ** negative * right-end-position: ** 74607 * left-end-position: ** 70801 * centisome-position: ** 17.641855...")
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14807 ==
+
== Metabolite CPD-606 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** cdp-glycerol
−
* right-end-position:
+
* smiles:
−
** 74607
+
** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 70801
+
** hhpouccvoneprk-jbsykwbfsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 17.641855   
+
** 475.242
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
−
* [[RXN-12375]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=cdp-glycerol}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
−
* [[RXN-12376]]
+
{{#set: molecular-weight=475.242}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12377]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12378]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12379]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12380]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12381]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12382]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6829]]
 
−
** '''11''' reactions found over '''15''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=74607}}
 
−
{{#set: left-end-position=70801}}
 
−
{{#set: centisome-position=17.641855    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:33, 18 December 2020

Metabolite CPD-606

  • common-name:
    • cdp-glycerol
  • smiles:
    • c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
  • inchi-key:
    • hhpouccvoneprk-jbsykwbfsa-l
  • molecular-weight:
    • 475.242

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=ADENOSINE5TRIPHOSPHO5ADENOSINE&oldid=46910"