Difference between revisions of "ADENOSINE DIPHOSPHATE RIBOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Core-Protein-L-Ser-Xyl == * common-name: ** a [protein]-3-o-(β-d-xylosyl)-l-serine == Reaction(s) known to consume the compound == =...")
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Core-Protein-L-Ser-Xyl ==
+
== Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE ==
 
* common-name:
 
* common-name:
** a [protein]-3-o-(β-d-xylosyl)-l-serine
+
** adp-d-ribose
 +
* smiles:
 +
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
 +
* inchi-key:
 +
** srnwougrcwsemx-tyasjmozsa-l
 +
* molecular-weight:
 +
** 557.303
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ARDP]]
 +
* [[RXN0-1441]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.4.2.26-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-3-o-(β-d-xylosyl)-l-serine}}
+
{{#set: common-name=adp-d-ribose}}
 +
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
 +
{{#set: molecular-weight=557.303}}

Latest revision as of 11:13, 18 March 2021

Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE

  • common-name:
    • adp-d-ribose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
  • inchi-key:
    • srnwougrcwsemx-tyasjmozsa-l
  • molecular-weight:
    • 557.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality