Difference between revisions of "ADENOSINE DIPHOSPHATE RIBOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13358 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GLYOXIII-RXN ** Catego...")
 
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ13358 ==
+
== Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** adp-d-ribose
== Reaction(s) associated ==
+
* smiles:
* [[GLYOXIII-RXN]]
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** srnwougrcwsemx-tyasjmozsa-l
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* molecular-weight:
{{#set: nb reaction associated=1}}
+
** 557.303
 +
== Reaction(s) known to consume the compound ==
 +
* [[ARDP]]
 +
* [[RXN0-1441]]
 +
== Reaction(s) known to produce the compound ==
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=adp-d-ribose}}
 +
{{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}}
 +
{{#set: molecular-weight=557.303}}

Latest revision as of 11:13, 18 March 2021

Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE

  • common-name:
    • adp-d-ribose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
  • inchi-key:
    • srnwougrcwsemx-tyasjmozsa-l
  • molecular-weight:
    • 557.303

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality