Difference between revisions of "ADENOSINE DIPHOSPHATE RIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13358 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GLYOXIII-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == |
− | == | + | * common-name: |
− | * | + | ** adp-d-ribose |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-] |
− | * | + | * inchi-key: |
− | + | ** srnwougrcwsemx-tyasjmozsa-l | |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 557.303 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[ARDP]] | ||
+ | * [[RXN0-1441]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=adp-d-ribose}} | ||
+ | {{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}} | ||
+ | {{#set: molecular-weight=557.303}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE
- common-name:
- adp-d-ribose
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
- inchi-key:
- srnwougrcwsemx-tyasjmozsa-l
- molecular-weight:
- 557.303