Difference between revisions of "ADENOSINE DIPHOSPHATE RIBOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18348 == * common-name: ** 1-cis-vaccenoylglycerol-3-phosphate * smiles: ** ccccccc=ccccccccccc(=o)occ(cop(=o)([o-])[o-])o * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == * common-name: ** adp-d-ribose * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** adp-d-ribose |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** srnwougrcwsemx-tyasjmozsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 557.303 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARDP]] |
| − | + | * [[RXN0-1441]] | |
| − | |||
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adp-d-ribose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=srnwougrcwsemx-tyasjmozsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=557.303}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ADENOSINE_DIPHOSPHATE_RIBOSE
- common-name:
- adp-d-ribose
- smiles:
- c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op([o-])(=o)occ4(c(o)c(o)c(o4)o))(=o)[o-]
- inchi-key:
- srnwougrcwsemx-tyasjmozsa-l
- molecular-weight:
- 557.303
