Difference between revisions of "ADENOSYL-HOMO-CYS"

Revision as of 11:19, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-17540 ==
+== Metabolite CYS ==
 * common-name:
-** dapdiamide b
+** l-cysteine
 * smiles:
-** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
+** c(s)c(c(=o)[o-])[n+]
 * inchi-key:
-** wsfqksibzodgpb-ofaneystsa-n
+** xujnekjlayxesh-reohclbhsa-n
 * molecular-weight:
-** 314.341
+** 121.154
 == Reaction(s) known to consume the compound ==
+* [[ACSERLY-RXN]]
+* [[CYSPH-RXN]]
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTEINE--TRNA-LIGASE-RXN]]
+* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
+* [[CYSTEINE-DIOXYGENASE-RXN]]
+* [[GLUTCYSLIG-RXN]]
+* [[LCYSDESULF-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
+* [[P-PANTOCYSLIG-RXN]]
+* [[RXN-12588]]
+* [[RXN-14385]]
+* [[RXN-15129]]
+* [[RXN-15881]]
+* [[RXN-8351]]
+* [[RXN-9787]]
+* [[RXN0-308]]
+* [[RXN1G-121]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16292]]
+* [[1.8.3.5-RXN]]
+* [[ACSERLY-RXN]]
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
+* [[RXN-11623]]
+* [[RXN-14048]]
+* [[RXN-15130]]
+* [[RXN-16637]]
+* [[RXN-6622]]
+* [[RXN-9787]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dapdiamide b}}
+{{#set: common-name=l-cysteine}}
-{{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}}
+{{#set: inchi-key=inchikey=xujnekjlayxesh-reohclbhsa-n}}
-{{#set: molecular-weight=314.341}}
+{{#set: molecular-weight=121.154}}