Difference between revisions of "ADENOSYL-P4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDP == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** zwiadyzpowu...")
(Created page with "Category:metabolite == Metabolite ADENOSYL-P4 == * common-name: ** 5',5'''-diadenosine tetraphosphate * smiles: ** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDP ==
+
== Metabolite ADENOSYL-P4 ==
 
* common-name:
 
* common-name:
** cdp
+
** 5',5'''-diadenosine tetraphosphate
 
* smiles:
 
* smiles:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
+
** c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** zwiadyzpowuwew-xvfcmesisa-k
+
** yoahknvsncmzgq-xpwfqurosa-j
 
* molecular-weight:
 
* molecular-weight:
** 400.155
+
** 832.36
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATCD]]
+
* [[3.6.1.41-RXN]]
* [[ATCDm]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
* [[CDPKIN-RXN]]
 
* [[CDPREDUCT-RXN]]
 
* [[DCDT]]
 
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
 
* [[RXN-12198]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATCM]]
+
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
* [[DOLICHOL-KINASE-RXN]]
 
* [[RXN-11832]]
 
* [[RXN-12195]]
 
* [[RXN-12959]]
 
* [[RXN-15091]]
 
* [[RXN-7683]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp}}
+
{{#set: common-name=5',5'''-diadenosine tetraphosphate}}
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
+
{{#set: inchi-key=inchikey=yoahknvsncmzgq-xpwfqurosa-j}}
{{#set: molecular-weight=400.155}}
+
{{#set: molecular-weight=832.36}}

Latest revision as of 11:13, 18 March 2021

Metabolite ADENOSYL-P4

  • common-name:
    • 5',5-diadenosine tetraphosphate
  • smiles:
    • c(c1(c(c(c(o1)n3(c=nc2(c(=nc=nc=23)n)))o)o))op(op(op(op(occ4(c(c(c(o4)n6(c=nc5(c(=nc=nc=56)n)))o)o))([o-])=o)([o-])=o)([o-])=o)([o-])=o
  • inchi-key:
    • yoahknvsncmzgq-xpwfqurosa-j
  • molecular-weight:
    • 832.36

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality