Difference between revisions of "ADENOSYLHOMOCYSCAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc...")
 
(Created page with "Category:pathway == Pathway ADENOSYLHOMOCYSCAT-PWY == * taxonomic-range: ** tax-40674 * common-name: ** l-methionine salvage from l-homocysteine == Reaction(s) found == *...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] ==
+
== Pathway ADENOSYLHOMOCYSCAT-PWY ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** s-(2e,6e)-farnesyl-l-cysteine
+
** l-methionine salvage from l-homocysteine
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
+
* [[2.1.1.5-RXN]]
* inchi-key:
+
* [[HOMOCYSMETB12-RXN]]
** syslnqmklrogcl-bcyuyympsa-n
+
* [[MMUM-RXN]]
* molecular-weight:
+
== Reaction(s) not found ==
** 325.508
+
All reactions of this pathways are in present
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-40674}}
* [[RXN-11623]]
+
{{#set: common-name=l-methionine salvage from l-homocysteine}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=1.0}}
{{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}}
+
{{#set: nb total reaction=3}}
{{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}}
 
{{#set: molecular-weight=325.508}}
 

Latest revision as of 10:57, 18 March 2021

Pathway ADENOSYLHOMOCYSCAT-PWY

  • taxonomic-range:
    • tax-40674
  • common-name:
    • l-methionine salvage from l-homocysteine

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present