Difference between revisions of "ADENYLOSUCC"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Aromatic-Amino-Acids == * common-name: ** an aromatic amino acid == Reaction(s) known to consume the compound == * 2.6.1.57-RXN == Re...") |
(Created page with "Category:metabolite == Metabolite ADENYLOSUCC == * common-name: ** adenylo-succinate * smiles: ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ADENYLOSUCC == |
* common-name: | * common-name: | ||
| − | ** | + | ** adenylo-succinate |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-]))) | ||
| + | * inchi-key: | ||
| + | ** ofbhppmpbojxrt-dpxqiynjsa-j | ||
| + | * molecular-weight: | ||
| + | ** 459.265 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[AAL_LPAREN_fum_RPAREN_]] |
| + | * [[AMPSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADENYLOSUCCINATE-SYNTHASE-RXN]] |
| + | * [[AMPSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adenylo-succinate}} |
| + | {{#set: inchi-key=inchikey=ofbhppmpbojxrt-dpxqiynjsa-j}} | ||
| + | {{#set: molecular-weight=459.265}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite ADENYLOSUCC
- common-name:
- adenylo-succinate
- smiles:
- c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))
- inchi-key:
- ofbhppmpbojxrt-dpxqiynjsa-j
- molecular-weight:
- 459.265
