Difference between revisions of "ADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cellodextrins == * common-name: ** a cellodextrin == Reaction(s) known to consume the compound == * 3.2.1.91-RXN == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite ADP == * common-name: ** adp * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])[o-])([o-])=o * inchi-key: ** xtwy...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cellodextrins ==
+
== Metabolite ADP ==
 
* common-name:
 
* common-name:
** a cellodextrin
+
** adp
 +
* smiles:
 +
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])[o-])([o-])=o
 +
* inchi-key:
 +
** xtwytfmlzfpyci-kqynxxcusa-k
 +
* molecular-weight:
 +
** 424.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.91-RXN]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.7.11.14-RXN]]
 +
* [[2.7.11.15-RXN]]
 +
* [[2.7.11.16-RXN]]
 +
* [[2.7.11.18-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[2.7.11.25-RXN]]
 +
* [[2.7.11.30-RXN]]
 +
* [[2.7.11.4-RXN]]
 +
* [[2.7.11.7-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[2.7.4.10-RXN]]
 +
* [[3.6.4.5-RXN]]
 +
* [[5.99.1.3-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[ACOACXr]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ADP-DEAMINASE-RXN]]
 +
* [[ADPREDUCT-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 +
* [[ATPSYN-RXN]]
 +
* [[ATP_LPAREN_3h_RPAREN_th]]
 +
* [[ATP_LPAREN_3h_RPAREN_tm]]
 +
* [[CREATINE-KINASE-RXN]]
 +
* [[Cut1]]
 +
* [[DAOTO]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[PANTETHEINE-KINASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[R00157]]
 +
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 +
* [[RXN-10038]]
 +
* [[RXN-10068]]
 +
* [[RXN-10862]]
 +
* [[RXN-10948]]
 +
* [[RXN-12003]]
 +
* [[RXN-13139]]
 +
* [[RXN-13197]]
 +
* [[RXN-14120]]
 +
* [[RXN-14228]]
 +
* [[RXN-14906]]
 +
* [[RXN-15712]]
 +
* [[RXN-16294]]
 +
* [[RXN-16317]]
 +
* [[RXN-17924]]
 +
* [[RXN-4305]]
 +
* [[RXN-7186]]
 +
* [[RXN0-1061]]
 +
* [[RXN0-747]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2043]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
 +
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
 +
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.133-RXN]]
 +
* [[2.7.1.134-RXN]]
 +
* [[2.7.1.139-RXN]]
 +
* [[2.7.1.140-RXN]]
 +
* [[2.7.1.148-RXN]]
 +
* [[2.7.1.150-RXN]]
 +
* [[2.7.1.151-RXN]]
 +
* [[2.7.1.152-RXN]]
 +
* [[2.7.1.68-RXN]]
 +
* [[2.7.10.1-RXN]]
 +
* [[2.7.11.14-RXN]]
 +
* [[2.7.11.15-RXN]]
 +
* [[2.7.11.16-RXN]]
 +
* [[2.7.11.18-RXN]]
 +
* [[2.7.11.2-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[2.7.11.25-RXN]]
 +
* [[2.7.11.30-RXN]]
 +
* [[2.7.11.4-RXN]]
 +
* [[2.7.11.7-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[2.7.13.3-RXN]]
 +
* [[2.7.4.10-RXN]]
 +
* [[2.7.4.24-RXN]]
 +
* [[3.6.1.41-RXN]]
 +
* [[3.6.3.1-RXN]]
 +
* [[3.6.3.12-RXN]]
 +
* [[3.6.3.16-RXN]]
 +
* [[3.6.3.30-RXN]]
 +
* [[3.6.3.31-RXN]]
 +
* [[3.6.3.35-RXN]]
 +
* [[3.6.3.37-RXN]]
 +
* [[3.6.3.4-RXN]]
 +
* [[3.6.3.43-RXN]]
 +
* [[3.6.3.44-RXN]]
 +
* [[3.6.3.6-RXN]]
 +
* [[3.6.3.8-RXN]]
 +
* [[3.6.3.9-RXN]]
 +
* [[3.6.4.3-RXN]]
 +
* [[3.6.4.4-RXN]]
 +
* [[3.6.4.5-RXN]]
 +
* [[3.6.4.6-RXN]]
 +
* [[3.6.4.7-RXN]]
 +
* [[4.2.1.93-RXN]]
 +
* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
 +
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 +
* [[5.99.1.3-RXN]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[6.3.2.25-RXN]]
 +
* [[6.3.5.6-RXN]]
 +
* [[6.3.5.7-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[ABC-24-RXN]]
 +
* [[ABC-25-RXN]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[ADCPT]]
 +
* [[ADENOSINE-KINASE-RXN]]
 +
* [[ADENYL-KIN-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ADNK]]
 +
* [[ADNKm]]
 +
* [[ADP-DEAMINASE-RXN]]
 +
* [[AGK]]
 +
* [[AGPT]]
 +
* [[AIRS-RXN]]
 +
* [[AN2PT]]
 +
* [[ARPT]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ATAM]]
 +
* [[ATCD]]
 +
* [[ATCDm]]
 +
* [[ATCM]]
 +
* [[ATCY]]
 +
* [[ATDAM]]
 +
* [[ATDCD]]
 +
* [[ATDCDm]]
 +
* [[ATDCM]]
 +
* [[ATDGD]]
 +
* [[ATDGM]]
 +
* [[ATDTD]]
 +
* [[ATDTDm]]
 +
* [[ATDTM]]
 +
* [[ATDUD]]
 +
* [[ATDUDm]]
 +
* [[ATGD]]
 +
* [[ATID]]
 +
* [[ATIDm]]
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPASE-RXN]]
 +
* [[ATPCL]]
 +
* [[ATPSYN-RXN]]
 +
* [[ATP_LPAREN_3h_RPAREN_th]]
 +
* [[ATP_LPAREN_3h_RPAREN_tm]]
 +
* [[ATUD]]
 +
* [[ATUDm]]
 +
* [[AUPT]]
 +
* [[BIOTIN-CARBOXYL-RXN]]
 +
* [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CDPKIN-RXN]]
 +
* [[CHOLINE-KINASE-RXN]]
 +
* [[CREATINE-KINASE-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[DADPKIN-RXN]]
 +
* [[DALADALALIG-RXN]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 +
* [[DEPHOSPHOCOAKIN-RXN]]
 +
* [[DETHIOBIOTIN-SYN-RXN]]
 +
* [[DGDPKIN-RXN]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[DTDPKIN-RXN]]
 +
* [[DTMPKI-RXN]]
 +
* [[DUDPKIN-RXN]]
 +
* [[ETHANOLAMINE-KINASE-RXN]]
 +
* [[FE3abch]]
 +
* [[FGAMSYN-RXN]]
 +
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[FTHFL]]
 +
* [[FUCOKINASE-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[GDPKIN-RXN]]
 +
* [[GLUCOKIN-RXN]]
 +
* [[GLUCONOKIN-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[GLUTKIN-RXN]]
 +
* [[GLY3KIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GLYCERONE-KINASE-RXN]]
 +
* [[GLYRIBONUCSYN-RXN]]
 +
* [[GUANYL-KIN-RXN]]
 +
* [[HEXOKINASE-RXN]]
 +
* [[HOMOSERKIN-RXN]]
 +
* [[MANNKIN-RXN]]
 +
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
 +
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[NAD-KIN-RXN]]
 +
* [[NADH-KINASE-RXN]]
 +
* [[NDPK]]
 +
* [[NDPKm]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[OHMETPYRKIN-RXN]]
 +
* [[PANTETHEINE-KINASE-RXN]]
 +
* [[PANTOTHENATE-KIN-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PFK_]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[PNKIN-RXN]]
 +
* [[POLYNUCLEOTIDE-5-HYDROXYL-KINASE-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[PROTEIN-KINASE-RXN]]
 +
* [[PSEUDOURIDINE-KINASE-RXN]]
 +
* [[PYRAMKIN-RXN]]
 +
* [[PYRIDOXKIN-RXN]]
 +
* [[PYRIMSYN3-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[R00157]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[RIBOKIN-RXN]]
 +
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 +
* [[RXN-10038]]
 +
* [[RXN-10068]]
 +
* [[RXN-10948]]
 +
* [[RXN-10971]]
 +
* [[RXN-10972]]
 +
* [[RXN-10973]]
 +
* [[RXN-10974]]
 +
* [[RXN-10979]]
 +
* [[RXN-11109]]
 +
* [[RXN-11135]]
 +
* [[RXN-11136]]
 +
* [[RXN-11376]]
 +
* [[RXN-11832]]
 +
* [[RXN-12002]]
 +
* [[RXN-12003]]
 +
* [[RXN-12005]]
 +
* [[RXN-13139]]
 +
* [[RXN-13197]]
 +
* [[RXN-13202]]
 +
* [[RXN-14120]]
 +
* [[RXN-14196]]
 +
* [[RXN-14223]]
 +
* [[RXN-14228]]
 +
* [[RXN-14325]]
 +
* [[RXN-14455]]
 +
* [[RXN-14906]]
 +
* [[RXN-15005]]
 +
* [[RXN-16291]]
 +
* [[RXN-16292]]
 +
* [[RXN-16293]]
 +
* [[RXN-16294]]
 +
* [[RXN-16317]]
 +
* [[RXN-16909]]
 +
* [[RXN-16991]]
 +
* [[RXN-6341]]
 +
* [[RXN-7162]]
 +
* [[RXN-7163]]
 +
* [[RXN-7184]]
 +
* [[RXN-7186]]
 +
* [[RXN-7614]]
 +
* [[RXN-7913]]
 +
* [[RXN-8443]]
 +
* [[RXN0-1061]]
 +
* [[RXN0-2921]]
 +
* [[RXN0-4261]]
 +
* [[RXN1F-20]]
 +
* [[RXN1G-4355]]
 +
* [[RXN3DJ-11417]]
 +
* [[RXN3O-458]]
 +
* [[SAICARSYN-RXN]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[SPHINGANINE-KINASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SULFATE-ADENYLYLTRANSFERASE-ADP-RXN]]
 +
* [[TAGAKIN-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
* [[THIAZOLSYN3-RXN]]
 +
* [[TRANS-RXN-193]]
 +
* [[TRANS-RXN-2]]
 +
* [[TRANS-RXN-311]]
 +
* [[TRIOKINASE-RXN]]
 +
* [[UDPKIN-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[XYLULOKIN-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cellodextrin}}
+
{{#set: common-name=adp}}
 +
{{#set: inchi-key=inchikey=xtwytfmlzfpyci-kqynxxcusa-k}}
 +
{{#set: molecular-weight=424.18}}

Latest revision as of 11:14, 18 March 2021

Metabolite ADP

  • common-name:
    • adp
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])[o-])([o-])=o
  • inchi-key:
    • xtwytfmlzfpyci-kqynxxcusa-k
  • molecular-weight:
    • 424.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality