Difference between revisions of "ADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...") |
(Created page with "Category:metabolite == Metabolite Cellodextrins == * common-name: ** a cellodextrin == Reaction(s) known to consume the compound == * 3.2.1.91-RXN == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cellodextrins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cellodextrin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.2.1.91-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2043]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cellodextrin}} |
| − | |||
| − | |||
Revision as of 13:10, 14 January 2021
Contents
Metabolite Cellodextrins
- common-name:
- a cellodextrin
