Difference between revisions of "ADP-D-Ribosyl-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...")
(Created page with "Category:metabolite == Metabolite ADP-D-Ribosyl-Acceptors == * common-name: ** an adp-d-ribosyl acceptor == Reaction(s) known to consume the compound == * NAD+-ADP-RIBOS...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MENADIOL ==
+
== Metabolite ADP-D-Ribosyl-Acceptors ==
 
* common-name:
 
* common-name:
** menadiol
+
** an adp-d-ribosyl acceptor
* smiles:
 
** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2))
 
* inchi-key:
 
** zjtlzydqjhkrmq-uhfffaoysa-n
 
* molecular-weight:
 
** 174.199
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
+
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menadiol}}
+
{{#set: common-name=an adp-d-ribosyl acceptor}}
{{#set: inchi-key=inchikey=zjtlzydqjhkrmq-uhfffaoysa-n}}
 
{{#set: molecular-weight=174.199}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite ADP-D-Ribosyl-Acceptors

  • common-name:
    • an adp-d-ribosyl acceptor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality