Difference between revisions of "ADP-D-Ribosyl-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-6224 == * common-name: ** gibberellin a34 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-6224 == |
* common-name: | * common-name: | ||
| − | ** | + | ** gibberellin a34 |
* smiles: | * smiles: | ||
| − | ** | + | ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** igziqajjxgrajf-oqaxfvlusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 347.387 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-6550]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=gibberellin a34}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=igziqajjxgrajf-oqaxfvlusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=347.387}} |
Revision as of 13:08, 14 January 2021
Contents
Metabolite CPD-6224
- common-name:
- gibberellin a34
- smiles:
- c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
- inchi-key:
- igziqajjxgrajf-oqaxfvlusa-m
- molecular-weight:
- 347.387
