Difference between revisions of "ADP-D-Ribosyl-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6224 == * common-name: ** gibberellin a34 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))...")
(Created page with "Category:metabolite == Metabolite CPD-514 == * common-name: ** 3-oxo-3-phenylpropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6224 ==
+
== Metabolite CPD-514 ==
 
* common-name:
 
* common-name:
** gibberellin a34
+
** 3-oxo-3-phenylpropanoyl-coa
 
* smiles:
 
* smiles:
** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** igziqajjxgrajf-oqaxfvlusa-m
+
** nhdpiyiccbknnj-fueukbnzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 347.387
+
** 909.648
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-2006]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6550]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a34}}
+
{{#set: common-name=3-oxo-3-phenylpropanoyl-coa}}
{{#set: inchi-key=inchikey=igziqajjxgrajf-oqaxfvlusa-m}}
+
{{#set: inchi-key=inchikey=nhdpiyiccbknnj-fueukbnzsa-j}}
{{#set: molecular-weight=347.387}}
+
{{#set: molecular-weight=909.648}}

Revision as of 18:53, 14 January 2021

Metabolite CPD-514

  • common-name:
    • 3-oxo-3-phenylpropanoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • nhdpiyiccbknnj-fueukbnzsa-j
  • molecular-weight:
    • 909.648

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality