Difference between revisions of "ADP-SUGARS"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...") |
(Created page with "Category:metabolite == Metabolite Adenine-34-in-tRNAs == * common-name: ** an adenine34 in trna == Reaction(s) known to consume the compound == * RXN-13997 == Reaction...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Adenine-34-in-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an adenine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13997]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13997]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an adenine34 in trna}} |
| − | |||
| − | |||
Revision as of 08:29, 15 March 2021
Contents
Metabolite Adenine-34-in-tRNAs
- common-name:
- an adenine34 in trna
