Difference between revisions of "AGMATHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite STEAROYL-COA == * common-name: ** stearoyl-coa * smiles: ** cccccccccccccccccc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(...") |
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) * inchi-key: ** dxdrhhkmwqzjht...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3041 == |
* common-name: | * common-name: | ||
| − | ** | + | ** isoliquiritigenin |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dxdrhhkmwqzjht-fpygclrlsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.257 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-3221]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-3142]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=isoliquiritigenin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dxdrhhkmwqzjht-fpygclrlsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.257}} |
Revision as of 18:59, 14 January 2021
Contents
Metabolite CPD-3041
- common-name:
- isoliquiritigenin
- smiles:
- c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2)
- inchi-key:
- dxdrhhkmwqzjht-fpygclrlsa-n
- molecular-weight:
- 256.257
