Difference between revisions of "AGMATHINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3041 == * common-name: ** isoliquiritigenin * smiles: ** c2(c=c(o)c=cc(c=cc(=o)c1(c(=cc(o)=cc=1)o))=2) * inchi-key: ** dxdrhhkmwqzjht...") |
(Created page with "Category:metabolite == Metabolite AGMATHINE == * common-name: ** agmatine * smiles: ** c(ccc[n+])nc(=[n+])n * inchi-key: ** qyppjabkjhavhs-uhfffaoysa-p * molecular-weight:...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AGMATHINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** agmatine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(ccc[n+])nc(=[n+])n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qyppjabkjhavhs-uhfffaoysa-p |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 132.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[AGMATIN-RXN]] |
| + | * [[AGMATINE-DEIMINASE-RXN]] | ||
| + | * [[ARGDECARBOX-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ARGDECARBOX-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=agmatine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qyppjabkjhavhs-uhfffaoysa-p}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=132.208}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite AGMATHINE
- common-name:
- agmatine
- smiles:
- c(ccc[n+])nc(=[n+])n
- inchi-key:
- qyppjabkjhavhs-uhfffaoysa-p
- molecular-weight:
- 132.208
