Difference between revisions of "AICAR"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9287 RXN-9287] == * direction: ** left-to-right * common-name: ** heptaprenyldihydroxybenzoate...") |
(Created page with "Category:metabolite == Metabolite AICAR == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite AICAR == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide |
− | * | + | * smiles: |
− | ** [ | + | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2)) |
− | * | + | * inchi-key: |
− | ** | + | ** notgfiuvdgnkri-uuokfmhzsa-l |
− | == Reaction | + | * molecular-weight: |
− | * | + | ** 336.197 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[AIAL]] |
− | * | + | * [[AICARSYN-RXN]] |
− | * | + | * [[AICARTRANSFORM-RXN]] |
− | + | * [[FPAIF]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[AIAL]] | |
− | + | * [[AICARSYN-RXN]] | |
− | * | + | * [[AICARTRANSFORM-RXN]] |
− | == | + | * [[FPAIF]] |
− | + | * [[GLUTAMIDOTRANS-RXN]] | |
− | + | * [[RXN-14270]] | |
− | + | * [[RXN-17900]] | |
− | {{#set: common-name= | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}} | |
− | + | {{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}} | |
− | {{#set: | + | {{#set: molecular-weight=336.197}} |
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite AICAR
- common-name:
- 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
- inchi-key:
- notgfiuvdgnkri-uuokfmhzsa-l
- molecular-weight:
- 336.197