Difference between revisions of "AICAR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9287 RXN-9287] == * direction: ** left-to-right * common-name: ** heptaprenyldihydroxybenzoate...")
(Created page with "Category:metabolite == Metabolite AICAR == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9287 RXN-9287] ==
+
== Metabolite AICAR ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** heptaprenyldihydroxybenzoate methyltransferase
+
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.114 ec-2.1.1.114]
+
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
* synonymous:
+
* inchi-key:
** 3-heptaprenyl-4,5-dihydroxybenzoate methyltransferase
+
** notgfiuvdgnkri-uuokfmhzsa-l
== Reaction formula ==
+
* molecular-weight:
* 1 [[CPD-9903]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-9904]][c] '''+''' 1 [[PROTON]][c]
+
** 336.197
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ13007]]
+
* [[AIAL]]
** Category: [[annotation]]
+
* [[AICARSYN-RXN]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[AICARTRANSFORM-RXN]]
== Pathway(s)  ==
+
* [[FPAIF]]
* [[PWY-5873]], ubiquinol-7 biosynthesis (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5873 PWY-5873]
+
== Reaction(s) known to produce the compound ==
** '''3''' reactions found over '''8''' reactions in the full pathway
+
* [[AIAL]]
== Reconstruction information  ==
+
* [[AICARSYN-RXN]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AICARTRANSFORM-RXN]]
== External links  ==
+
* [[FPAIF]]
* RHEA:
+
* [[GLUTAMIDOTRANS-RXN]]
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44481 44481]
+
* [[RXN-14270]]
{{#set: direction=left-to-right}}
+
* [[RXN-17900]]
{{#set: common-name=heptaprenyldihydroxybenzoate methyltransferase}}
+
== Reaction(s) of unknown directionality ==
{{#set: ec-number=ec-2.1.1.114}}
+
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
{{#set: synonymous=3-heptaprenyl-4,5-dihydroxybenzoate methyltransferase}}
+
{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=336.197}}
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite AICAR

  • common-name:
    • 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
  • smiles:
    • c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
  • inchi-key:
    • notgfiuvdgnkri-uuokfmhzsa-l
  • molecular-weight:
    • 336.197

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality