Difference between revisions of "ALA-GLY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
(Created page with "Category:metabolite == Metabolite ALA-GLY == * common-name: ** l-alanyl-glycine * smiles: ** cc([n+])c(ncc([o-])=o)=o * inchi-key: ** cxispyvymqwfle-vkhmyheasa-n * molecul...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14158 ==
+
== Metabolite ALA-GLY ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** l-alanyl-glycine
 
* smiles:
 
* smiles:
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
+
** cc([n+])c(ncc([o-])=o)=o
 
* inchi-key:
 
* inchi-key:
** yppfejhohnpklt-pbsuhmdjsa-s
+
** cxispyvymqwfle-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 515.583
+
** 146.146
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-6977]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
 
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=l-alanyl-glycine}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
+
{{#set: inchi-key=inchikey=cxispyvymqwfle-vkhmyheasa-n}}
{{#set: molecular-weight=515.583}}
+
{{#set: molecular-weight=146.146}}

Latest revision as of 11:11, 18 March 2021

Metabolite ALA-GLY

  • common-name:
    • l-alanyl-glycine
  • smiles:
    • cc([n+])c(ncc([o-])=o)=o
  • inchi-key:
    • cxispyvymqwfle-vkhmyheasa-n
  • molecular-weight:
    • 146.146

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality