Difference between revisions of "ALA-GLY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
(Created page with "Category:metabolite == Metabolite AMINO-OXOBUT == * common-name: ** l-2-amino-3-oxobutanoate * smiles: ** cc(=o)c([n+])c([o-])=o * inchi-key: ** sauchdkdcuroao-vkhmyheasa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14158 ==
+
== Metabolite AMINO-OXOBUT ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** l-2-amino-3-oxobutanoate
 
* smiles:
 
* smiles:
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
+
** cc(=o)c([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** yppfejhohnpklt-pbsuhmdjsa-s
+
** sauchdkdcuroao-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 515.583
+
** 117.104
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[AKBLIG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
+
* [[THREODEHYD-RXN]]
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=l-2-amino-3-oxobutanoate}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
+
{{#set: inchi-key=inchikey=sauchdkdcuroao-vkhmyheasa-n}}
{{#set: molecular-weight=515.583}}
+
{{#set: molecular-weight=117.104}}

Revision as of 14:54, 5 January 2021

Metabolite AMINO-OXOBUT

  • common-name:
    • l-2-amino-3-oxobutanoate
  • smiles:
    • cc(=o)c([n+])c([o-])=o
  • inchi-key:
    • sauchdkdcuroao-vkhmyheasa-n
  • molecular-weight:
    • 117.104

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality