Difference between revisions of "ALACAT2-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-2Fe-2S-Ferredoxins Oxidized-2Fe-2S-Ferredoxins] == * common-name: ** an oxidized [2fe-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * common-name: ** o-succinyl-l-homoserine *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** o-succinyl-l-homoserine |
| + | * smiles: | ||
| + | ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** gnisqjgxjidkdj-yfkpbyrvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 218.186 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[METBALT-RXN]] | ||
| + | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
| + | * [[RXN-9384]] | ||
| + | * [[SUCHMSSELCYSL]] | ||
| + | * [[SUCHMSSELCYSLh]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HOMSUCTRAN-RXN]] |
| − | * [[ | + | * [[O-SUCCHOMOSERLYASE-RXN]] |
| − | + | * [[RXN-9384]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=o-succinyl-l-homoserine}} |
| + | {{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}} | ||
| + | {{#set: molecular-weight=218.186}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite O-SUCCINYL-L-HOMOSERINE
- common-name:
- o-succinyl-l-homoserine
- smiles:
- c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
- inchi-key:
- gnisqjgxjidkdj-yfkpbyrvsa-m
- molecular-weight:
- 218.186
