Difference between revisions of "ALANINE-VALINESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13394 CPD-13394] == * common-name: ** glycyl-l-glutamine * smiles: ** c([n+])c(=o)nc(c([o-]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine Protein-L-methionine] == * common-name: ** a [protein]-l-methionine == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13394 CPD-13394] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine Protein-L-methionine] ==
 
* common-name:
 
* common-name:
** glycyl-l-glutamine
+
** a [protein]-l-methionine
* smiles:
 
** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n
 
* inchi-key:
 
** pnmuaggsdzxthx-bypyzucnsa-n
 
* molecular-weight:
 
** 203.197
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6983]]
+
* [[1.8.4.12-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.8.4.12-RXN]]
 +
* [[RXN-8668]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycyl-l-glutamine}}
+
{{#set: common-name=a [protein]-l-methionine}}
{{#set: inchi-key=inchikey=pnmuaggsdzxthx-bypyzucnsa-n}}
 
{{#set: molecular-weight=203.197}}
 

Revision as of 14:19, 26 August 2019

Metabolite Protein-L-methionine

  • common-name:
    • a [protein]-l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.