Difference between revisions of "ALL-TRANS-HEXAPRENYL-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Drugs == * common-name: ** a drug == Reaction(s) known to consume the compound == * TRANS-RXN-311 == Reaction(s) known to produce the...")
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-hexaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Drugs ==
+
== Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** a drug
+
** all-trans-hexaprenyl diphosphate
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 +
* inchi-key:
 +
** ngfsmhkftzrokj-mmszmyibsa-k
 +
* molecular-weight:
 +
** 583.66
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRANS-RXN-311]]
+
* [[RXN-9003]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRANS-RXN-311]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a drug}}
+
{{#set: common-name=all-trans-hexaprenyl diphosphate}}
 +
{{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}}
 +
{{#set: molecular-weight=583.66}}

Latest revision as of 11:13, 18 March 2021

Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-hexaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ngfsmhkftzrokj-mmszmyibsa-k
  • molecular-weight:
    • 583.66

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality